86-26-0 2-Methoxybiphenyl
| Nome do produto |
2-Methoxybiphenyl |
| Nome em inglês |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Fórmula molecular |
C13H12O |
| Peso Molecular |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS Registry Number |
86-26-0 |
| EINECS |
201-659-9 |
| Estrutura Molecular |
|
| Densidade |
1.03g/cm3 |
| Ponto de fus?o |
30-33℃ |
| Ponto de ebuli??o |
274°C at 760 mmHg |
| índice de refra??o |
1.556 |
| O ponto de inflama??o |
101.3°C |
| Press?o de vapor |
0.00928mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R33:Danger of cummulative effects.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|