86-26-0 2-Methoxybiphenyl
| Nama produk |
2-Methoxybiphenyl |
| Nama Inggeris |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| MF |
C13H12O |
| Berat Molekul |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS NO |
86-26-0 |
| EINECS |
201-659-9 |
| Struktur Molekul |
|
| Kepadatan |
1.03g/cm3 |
| Titik lebur |
30-33℃ |
| Titik didih |
274°C at 760 mmHg |
| Indeks bias |
1.556 |
| Titik nyala |
101.3°C |
| Tekanan wap |
0.00928mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R33:Danger of cummulative effects.;
|
| Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|