86-26-0 2-Methoxybiphenyl
| Nome del prodotto |
2-Methoxybiphenyl |
| Nome inglese |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Formula molecolare |
C13H12O |
| Peso Molecolare |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| Numero CAS |
86-26-0 |
| EINECS |
201-659-9 |
| Struttura molecolare |
|
| Densità |
1.03g/cm3 |
| Punto di fusione |
30-33℃ |
| Punto di ebollizione |
274°C at 760 mmHg |
| Indice di rifrazione |
1.556 |
| Punto d'infiammabilità |
101.3°C |
| Pressione di vapore |
0.00928mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R33:Danger of cummulative effects.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|