637-53-6 Thioacetanilide
| ürün Ad? |
Thioacetanilide |
| ingilizce ad? |
Thioacetanilide; 98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
| Moleküler Formülü |
C8H9NS |
| Molekül A??rl??? |
151.2288 |
| InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| CAS kay?t numaras? |
637-53-6 |
| EINECS |
211-288-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.16g/cm3 |
| Ergime noktas? |
76-79℃ |
| Kaynama noktas? |
225.121°C at 760 mmHg |
| K?r?lma indisi |
1.654 |
| Alevlenme noktas? |
89.95°C |
| Buhar bas?nc? |
0.088mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|