637-53-6 Thioacetanilide
| Naam product |
Thioacetanilide |
| Engelse naam |
Thioacetanilide; 98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
| MF |
C8H9NS |
| Molecuulgewicht |
151.2288 |
| InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| CAS-nummer |
637-53-6 |
| EINECS |
211-288-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.16g/cm3 |
| Smeltpunt |
76-79℃ |
| Kookpunt |
225.121°C at 760 mmHg |
| Brekingsindex |
1.654 |
| Vlampunt |
89.95°C |
| Dampdruk |
0.088mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|