637-53-6 Thioacetanilide
| produktnavn |
Thioacetanilide |
| Engelsk navn |
Thioacetanilide; 98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
| Molekyl?r Formel |
C8H9NS |
| Molekylvekt |
151.2288 |
| InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| CAS-nummer |
637-53-6 |
| EINECS |
211-288-4 |
| Molecular Structure |
|
| Tetthet |
1.16g/cm3 |
| Smeltepunkt |
76-79℃ |
| Kokepunkt |
225.121°C at 760 mmHg |
| Brytningsindeks |
1.654 |
| Flammepunktet |
89.95°C |
| Damptrykk |
0.088mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|