637-53-6 Thioacetanilide
| Nome do produto |
Thioacetanilide |
| Nome em inglês |
Thioacetanilide; 98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
| Fórmula molecular |
C8H9NS |
| Peso Molecular |
151.2288 |
| InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| CAS Registry Number |
637-53-6 |
| EINECS |
211-288-4 |
| Estrutura Molecular |
|
| Densidade |
1.16g/cm3 |
| Ponto de fus?o |
76-79℃ |
| Ponto de ebuli??o |
225.121°C at 760 mmHg |
| índice de refra??o |
1.654 |
| O ponto de inflama??o |
89.95°C |
| Press?o de vapor |
0.088mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|