637-53-6 Thioacetanilide
| Produkt-Name |
Thioacetanilide |
| Englischer Name |
Thioacetanilide; 98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
| Molekulare Formel |
C8H9NS |
| Molecular Weight |
151.2288 |
| InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| CAS Registry Number |
637-53-6 |
| EINECS |
211-288-4 |
| Molecular Structure |
|
| Dichte |
1.16g/cm3 |
| Schmelzpunkt |
76-79℃ |
| Siedepunkt |
225.121°C at 760 mmHg |
| Brechungsindex |
1.654 |
| Flammpunkt |
89.95°C |
| Dampfdruck |
0.088mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|