6138-90-5 Geranyl Bromide
| ürün Ad? |
Geranyl Bromide |
| ingilizce ad? |
Geranyl Bromide; 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
| Moleküler Formülü |
C10H17Br |
| Molekül A??rl??? |
217.146 |
| InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| CAS kay?t numaras? |
6138-90-5 |
| EINECS |
228-123-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.121g/cm3 |
| Kaynama noktas? |
227.7°C at 760 mmHg |
| K?r?lma indisi |
1.489 |
| Alevlenme noktas? |
95°C |
| Buhar bas?nc? |
0.115mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|