6138-90-5 Geranyl Bromide
| product Name |
Geranyl Bromide |
| CAS No |
6138-90-5 |
| Synonyms |
3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
| Molecular Formula |
C10H17Br |
| Molecular Weight |
217.146 |
| InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| EINECS |
228-123-7 |
| Molecular Structure |
|
| Density |
1.121g/cm3 |
| Boiling point |
227.7°C at 760 mmHg |
| Refractive index |
1.489 |
| Flash point |
95°C |
| Vapour Pressur |
0.115mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|