6138-90-5 Geranyl Bromide
| ??? ????? |
Geranyl Bromide |
| ??? ??????? |
Geranyl Bromide; 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
| ????? ???????? |
C10H17Br |
| ??? ??????? |
217.146 |
| InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| ????? ?????? |
6138-90-5 |
| ????? ??????? ??????? |
228-123-7 |
| ?????? ??????? |
|
| ????? |
1.121g/cm3 |
| ???? ????? |
227.7°C at 760 mmHg |
| ???? ???? |
1.489 |
| ???? ?????? |
95°C |
| ???? ???? |
0.115mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|