6138-90-5 Geranyl Bromide
| ??? ?????? |
Geranyl Bromide |
| ????? ??????????? |
Geranyl Bromide; 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
| ?????? ???????? |
C10H17Br |
| ????? ??????? ??????? |
217.146 |
| InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| ?????????? ???????? ??????? |
6138-90-5 |
| ???????? ????????? ??? |
228-123-7 |
| ???? ?????? |
|
| ????? |
1.121g/cm3 |
| ???? ??????? |
227.7°C at 760 mmHg |
| ????? ???????? |
1.489 |
| ???? ?????? |
95°C |
| ??? ?????? |
0.115mmHg at 25°C |
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|