6138-90-5 Geranyl Bromide
| Nome do produto |
Geranyl Bromide |
| Nome em inglês |
Geranyl Bromide; 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
| Fórmula molecular |
C10H17Br |
| Peso Molecular |
217.146 |
| InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| CAS Registry Number |
6138-90-5 |
| EINECS |
228-123-7 |
| Estrutura Molecular |
|
| Densidade |
1.121g/cm3 |
| Ponto de ebuli??o |
227.7°C at 760 mmHg |
| índice de refra??o |
1.489 |
| O ponto de inflama??o |
95°C |
| Press?o de vapor |
0.115mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|