ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| ürün Ad? |
Methyl cyclopentanecarboxylate |
| ingilizce ad? |
Methyl cyclopentanecarboxylate; Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate; Cyclopentane-1-carboxylic acid methyl este |
| Moleküler Formülü |
C7H12O2 |
| Molekül A??rl??? |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| CAS kay?t numaras? |
4630-80-2 |
| EINECS |
225-049-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.014g/cm3 |
| Kaynama noktas? |
159°C at 760 mmHg |
| K?r?lma indisi |
1.45 |
| Alevlenme noktas? |
43.6°C |
| Buhar bas?nc? |
2.55mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|