ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| product Name |
Methyl cyclopentanecarboxylate |
| CAS No |
4630-80-2 |
| Synonyms |
Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate; Cyclopentane-1-carboxylic acid methyl este |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| EINECS |
225-049-7 |
| Molecular Structure |
|
| Density |
1.014g/cm3 |
| Boiling point |
159°C at 760 mmHg |
| Refractive index |
1.45 |
| Flash point |
43.6°C |
| Vapour Pressur |
2.55mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Miss Lu |
| Telephone |
+86-573-84183630 |
| Email |
jinlu@chengdapharm.com |
| Address |
NO.36, Huanghe Road, Huimin District, Jiashan, Zhejiang, China |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Specifications |
99% min |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |