ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| Ονομασ?α του προ??ντο? |
Methyl cyclopentanecarboxylate |
| Αγγλικ? ?νομα |
Methyl cyclopentanecarboxylate; Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate; Cyclopentane-1-carboxylic acid methyl este |
| MF |
C7H12O2 |
| Μοριακ? β?ρο? |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| CAS ΟΧΙ |
4630-80-2 |
| EINECS |
225-049-7 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.014g/cm3 |
| Σημε?ο βρασμο? |
159°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.45 |
| Σημε?ο αν?φλεξη? |
43.6°C |
| Π?εση ατμ?ν |
2.55mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|