ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| termék neve |
Methyl cyclopentanecarboxylate |
| Angol név |
Methyl cyclopentanecarboxylate; Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate; Cyclopentane-1-carboxylic acid methyl este |
| MF |
C7H12O2 |
| Molekulat?meg |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| CAS-szám |
4630-80-2 |
| EINECS |
225-049-7 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.014g/cm3 |
| Forráspont |
159°C at 760 mmHg |
| T?résmutató |
1.45 |
| Gyulladáspont |
43.6°C |
| G?znyomás |
2.55mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|