ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| produktnavn |
Methyl cyclopentanecarboxylate |
| Engelsk navn |
Methyl cyclopentanecarboxylate; Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate; Cyclopentane-1-carboxylic acid methyl este |
| Molekyl?r Formel |
C7H12O2 |
| Molekylvekt |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| CAS-nummer |
4630-80-2 |
| EINECS |
225-049-7 |
| Molecular Structure |
|
| Tetthet |
1.014g/cm3 |
| Kokepunkt |
159°C at 760 mmHg |
| Brytningsindeks |
1.45 |
| Flammepunktet |
43.6°C |
| Damptrykk |
2.55mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|