ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
| ürün Ad? |
4-Chloro-3-nitrocoumarin |
| ingilizce ad? |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
| Moleküler Formülü |
C9H4ClNO4 |
| Molekül A??rl??? |
225.5854 |
| InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| CAS kay?t numaras? |
38464-20-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.6g/cm3 |
| Ergime noktas? |
160-164℃ |
| Kaynama noktas? |
338.7°C at 760 mmHg |
| K?r?lma indisi |
1.642 |
| Alevlenme noktas? |
158.6°C |
| Buhar bas?nc? |
9.68E-05mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|