ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
| Nazwa produktu: |
4-Chloro-3-nitrocoumarin |
| Angielska nazwa |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
| MF |
C9H4ClNO4 |
| Masie cz?steczkowej |
225.5854 |
| InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| Nr CAS |
38464-20-9 |
| Struktury molekularnej |
|
| G?sto?? |
1.6g/cm3 |
| Temperatura topnienia |
160-164℃ |
| Temperatura wrzenia |
338.7°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.642 |
| Temperatura zap?onu |
158.6°C |
| Ci?nienie pary |
9.68E-05mmHg at 25°C |
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|