ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
| Produkt-Name |
4-Chloro-3-nitrocoumarin |
| Englischer Name |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
| Molekulare Formel |
C9H4ClNO4 |
| Molecular Weight |
225.5854 |
| InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| CAS Registry Number |
38464-20-9 |
| Molecular Structure |
|
| Dichte |
1.6g/cm3 |
| Schmelzpunkt |
160-164℃ |
| Siedepunkt |
338.7°C at 760 mmHg |
| Brechungsindex |
1.642 |
| Flammpunkt |
158.6°C |
| Dampfdruck |
9.68E-05mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|