ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
| Nome del prodotto |
4-Chloro-3-nitrocoumarin |
| Nome inglese |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
| Formula molecolare |
C9H4ClNO4 |
| Peso Molecolare |
225.5854 |
| InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| Numero CAS |
38464-20-9 |
| Struttura molecolare |
|
| Densità |
1.6g/cm3 |
| Punto di fusione |
160-164℃ |
| Punto di ebollizione |
338.7°C at 760 mmHg |
| Indice di rifrazione |
1.642 |
| Punto d'infiammabilità |
158.6°C |
| Pressione di vapore |
9.68E-05mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|