ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
| Nama produk |
4-Chloro-3-nitrocoumarin |
| Nama bahasa Inggris |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
| MF |
C9H4ClNO4 |
| Berat Molekul |
225.5854 |
| InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| CAS NO |
38464-20-9 |
| Struktur Molekul |
|
| Kepadatan |
1.6g/cm3 |
| Titik lebur |
160-164℃ |
| Titik didih |
338.7°C at 760 mmHg |
| Indeks bias |
1.642 |
| Titik nyala |
158.6°C |
| Tekanan uap |
9.68E-05mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|