1121-24-0 2-Hydroxythiophenol
| ürün Ad? |
2-Hydroxythiophenol |
| ingilizce ad? |
2-Hydroxythiophenol; 2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| Moleküler Formülü |
C6H6OS |
| Molekül A??rl??? |
126.1762 |
| InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| CAS kay?t numaras? |
1121-24-0 |
| EINECS |
214-326-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.255g/cm3 |
| Kaynama noktas? |
223.7°C at 760 mmHg |
| K?r?lma indisi |
1.642 |
| Alevlenme noktas? |
89.1°C |
| Buhar bas?nc? |
0.0636mmHg at 25°C |
| Risk Kodlar? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|