1121-24-0 2-Hydroxythiophenol
| ??? ?????? |
2-Hydroxythiophenol |
| ????? ??????????? |
2-Hydroxythiophenol; 2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| ?????? ???????? |
C6H6OS |
| ????? ??????? ??????? |
126.1762 |
| InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| ?????????? ???????? ??????? |
1121-24-0 |
| ???????? ????????? ??? |
214-326-8 |
| ???? ?????? |
|
| ????? |
1.255g/cm3 |
| ???? ??????? |
223.7°C at 760 mmHg |
| ????? ???????? |
1.642 |
| ???? ?????? |
89.1°C |
| ??? ?????? |
0.0636mmHg at 25°C |
| ??? ????????? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| ???? ????? |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|