1121-24-0 2-Hydroxythiophenol
| Nome do produto |
2-Hydroxythiophenol |
| Nome em inglês |
2-Hydroxythiophenol; 2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| Fórmula molecular |
C6H6OS |
| Peso Molecular |
126.1762 |
| InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| CAS Registry Number |
1121-24-0 |
| EINECS |
214-326-8 |
| Estrutura Molecular |
|
| Densidade |
1.255g/cm3 |
| Ponto de ebuli??o |
223.7°C at 760 mmHg |
| índice de refra??o |
1.642 |
| O ponto de inflama??o |
89.1°C |
| Press?o de vapor |
0.0636mmHg at 25°C |
| Códigos de risco |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|