1121-24-0 2-Hydroxythiophenol
| product Name |
2-Hydroxythiophenol |
| CAS No |
1121-24-0 |
| Synonyms |
2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| Molecular Formula |
C6H6OS |
| Molecular Weight |
126.1762 |
| InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| EINECS |
214-326-8 |
| Molecular Structure |
|
| Density |
1.255g/cm3 |
| Boiling point |
223.7°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
89.1°C |
| Vapour Pressur |
0.0636mmHg at 25°C |
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Telephone |
+86-571-88902504;88902507 |
| Email |
shoufu@shoufuchem.com |
| Address |
5/F, Yangfan Venture Plaza, 31 Xincheng Road, Binjiang District, Hangzhou City, Zhejiang Province, P.R.China |
| Telephone |
+86-519-88811381 |
| Email |
sales@longochem.com |
| Address |
BoAn international plaza, 15th floor, Buliding A,No.8, East Guangdian Road, Wujin District,Changzhou, Jiangsu, China |