1121-24-0 2-Hydroxythiophenol
| Ονομασ?α του προ??ντο? |
2-Hydroxythiophenol |
| Αγγλικ? ?νομα |
2-Hydroxythiophenol; 2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| MF |
C6H6OS |
| Μοριακ? β?ρο? |
126.1762 |
| InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| CAS ΟΧΙ |
1121-24-0 |
| EINECS |
214-326-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.255g/cm3 |
| Σημε?ο βρασμο? |
223.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.642 |
| Σημε?ο αν?φλεξη? |
89.1°C |
| Π?εση ατμ?ν |
0.0636mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|