101-99-5 N-Phenylurethane
| ürün Ad? |
N-Phenylurethane |
| ingilizce ad? |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| Moleküler Formülü |
C9H11NO2 |
| Molekül A??rl??? |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS kay?t numaras? |
101-99-5 |
| EINECS |
202-995-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.136g/cm3 |
| Kaynama noktas? |
238°C at 760 mmHg |
| K?r?lma indisi |
1.558 |
| Alevlenme noktas? |
79.2°C |
| Buhar bas?nc? |
0.0434mmHg at 25°C |
| Risk Kodlar? |
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|