101-99-5 N-Phenylurethane
| Nom |
N-Phenylurethane |
| Nom anglais |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| Formule moléculaire |
C9H11NO2 |
| Poids Moléculaire |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| Numéro de registre CAS |
101-99-5 |
| EINECS |
202-995-9 |
| Structure moléculaire |
|
| Densité |
1.136g/cm3 |
| Point d'ébullition |
238°C at 760 mmHg |
| Indice de réfraction |
1.558 |
| Point d'éclair |
79.2°C |
| Pression de vapeur |
0.0434mmHg at 25°C |
| Codes des risques |
R40:Possible risks of irreversible effects.;
|
| Description de sécurité |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|