101-99-5 N-Phenylurethane
| Nome do produto |
N-Phenylurethane |
| Nome em inglês |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| Fórmula molecular |
C9H11NO2 |
| Peso Molecular |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS Registry Number |
101-99-5 |
| EINECS |
202-995-9 |
| Estrutura Molecular |
|
| Densidade |
1.136g/cm3 |
| Ponto de ebuli??o |
238°C at 760 mmHg |
| índice de refra??o |
1.558 |
| O ponto de inflama??o |
79.2°C |
| Press?o de vapor |
0.0434mmHg at 25°C |
| Códigos de risco |
R40:Possible risks of irreversible effects.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|