101-99-5 N-Phenylurethane
| Ονομασ?α του προ??ντο? |
N-Phenylurethane |
| Αγγλικ? ?νομα |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| MF |
C9H11NO2 |
| Μοριακ? β?ρο? |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS ΟΧΙ |
101-99-5 |
| EINECS |
202-995-9 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.136g/cm3 |
| Σημε?ο βρασμο? |
238°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.558 |
| Σημε?ο αν?φλεξη? |
79.2°C |
| Π?εση ατμ?ν |
0.0434mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|