101-99-5 N-Phenylurethane
| Naam product |
N-Phenylurethane |
| Engelse naam |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| MF |
C9H11NO2 |
| Molecuulgewicht |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS-nummer |
101-99-5 |
| EINECS |
202-995-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.136g/cm3 |
| Kookpunt |
238°C at 760 mmHg |
| Brekingsindex |
1.558 |
| Vlampunt |
79.2°C |
| Dampdruk |
0.0434mmHg at 25°C |
| Risico-codes |
R40:Possible risks of irreversible effects.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|