38291-82-6 Valeric acid hydrazide
| ??? ?????? |
Valeric acid hydrazide |
| ????? ??????????? |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
| ?????? ???????? |
C5H12N2O |
| ????? ??????? ??????? |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| ?????????? ???????? ??????? |
38291-82-6 |
| ???????? ????????? ??? |
253-864-8 |
| ???? ?????? |
|
| ????? |
0.962g/cm3 |
| ???? ??????? |
260.6°C at 760 mmHg |
| ????? ???????? |
1.449 |
| ???? ?????? |
111.4°C |
| ??? ?????? |
0.0122mmHg at 25°C |
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|