38291-82-6 Valeric acid hydrazide
| Nama produk |
Valeric acid hydrazide |
| Nama bahasa Inggris |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
| MF |
C5H12N2O |
| Berat Molekul |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| CAS NO |
38291-82-6 |
| EINECS |
253-864-8 |
| Struktur Molekul |
|
| Kepadatan |
0.962g/cm3 |
| Titik didih |
260.6°C at 760 mmHg |
| Indeks bias |
1.449 |
| Titik nyala |
111.4°C |
| Tekanan uap |
0.0122mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|