38291-82-6 Valeric acid hydrazide
| Nome do produto |
Valeric acid hydrazide |
| Nome em inglês |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
| Fórmula molecular |
C5H12N2O |
| Peso Molecular |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| CAS Registry Number |
38291-82-6 |
| EINECS |
253-864-8 |
| Estrutura Molecular |
|
| Densidade |
0.962g/cm3 |
| Ponto de ebuli??o |
260.6°C at 760 mmHg |
| índice de refra??o |
1.449 |
| O ponto de inflama??o |
111.4°C |
| Press?o de vapor |
0.0122mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|