38291-82-6 Valeric acid hydrazide
| product Name |
Valeric acid hydrazide |
| CAS No |
38291-82-6 |
| Synonyms |
Pentanoic acid hydrazide; pentanehydrazide |
| Molecular Formula |
C5H12N2O |
| Molecular Weight |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| EINECS |
253-864-8 |
| Molecular Structure |
|
| Density |
0.962g/cm3 |
| Boiling point |
260.6°C at 760 mmHg |
| Refractive index |
1.449 |
| Flash point |
111.4°C |
| Vapour Pressur |
0.0122mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |