38291-82-6 Valeric acid hydrazide
| termék neve |
Valeric acid hydrazide |
| Angol név |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
| MF |
C5H12N2O |
| Molekulat?meg |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| CAS-szám |
38291-82-6 |
| EINECS |
253-864-8 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.962g/cm3 |
| Forráspont |
260.6°C at 760 mmHg |
| T?résmutató |
1.449 |
| Gyulladáspont |
111.4°C |
| G?znyomás |
0.0122mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|