ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| Название продукта |
3-fluoro-4-methoxybenzonitrile |
| Английское название |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
| Молекулярная формула |
C8H6FNO |
| Молекулярный вес |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| Регистрационный номер CAS |
331-62-4 |
| Молекулярная структура |
|
| Плотность |
1.18g/cm3 |
| Точка кипения |
254.3°C at 760 mmHg |
| Показатель преломления |
1.505 |
| Температура вспышки |
107.6°C |
| Давление пара |
0.0173mmHg at 25°C |
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|