ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| produktnavn |
3-fluoro-4-methoxybenzonitrile |
| Engelsk navn |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
| Molekyl?r Formel |
C8H6FNO |
| Molekylvekt |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS-nummer |
331-62-4 |
| Molecular Structure |
|
| Tetthet |
1.18g/cm3 |
| Kokepunkt |
254.3°C at 760 mmHg |
| Brytningsindeks |
1.505 |
| Flammepunktet |
107.6°C |
| Damptrykk |
0.0173mmHg at 25°C |
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|