ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| Nama produk |
3-fluoro-4-methoxybenzonitrile |
| Nama bahasa Inggris |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
| MF |
C8H6FNO |
| Berat Molekul |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS NO |
331-62-4 |
| Struktur Molekul |
|
| Kepadatan |
1.18g/cm3 |
| Titik didih |
254.3°C at 760 mmHg |
| Indeks bias |
1.505 |
| Titik nyala |
107.6°C |
| Tekanan uap |
0.0173mmHg at 25°C |
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|