ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| Ονομασ?α του προ??ντο? |
3-fluoro-4-methoxybenzonitrile |
| Αγγλικ? ?νομα |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
| MF |
C8H6FNO |
| Μοριακ? β?ρο? |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS ΟΧΙ |
331-62-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.18g/cm3 |
| Σημε?ο βρασμο? |
254.3°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.505 |
| Σημε?ο αν?φλεξη? |
107.6°C |
| Π?εση ατμ?ν |
0.0173mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|