ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| Nome del prodotto |
3-fluoro-4-methoxybenzonitrile |
| Nome inglese |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
| Formula molecolare |
C8H6FNO |
| Peso Molecolare |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| Numero CAS |
331-62-4 |
| Struttura molecolare |
|
| Densità |
1.18g/cm3 |
| Punto di ebollizione |
254.3°C at 760 mmHg |
| Indice di rifrazione |
1.505 |
| Punto d'infiammabilità |
107.6°C |
| Pressione di vapore |
0.0173mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|