455-67-4 3-fluoropropiophenone
| Nome do produto |
3-fluoropropiophenone |
| Nome em inglês |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| Fórmula molecular |
C9H9FO |
| Peso Molecular |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| CAS Registry Number |
455-67-4 |
| Estrutura Molecular |
|
| Densidade |
1.074g/cm3 |
| Ponto de ebuli??o |
209.8°C at 760 mmHg |
| índice de refra??o |
1.489 |
| O ponto de inflama??o |
79.8°C |
| Press?o de vapor |
0.199mmHg at 25°C |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|