455-67-4 3-fluoropropiophenone
| Nome del prodotto |
3-fluoropropiophenone |
| Nome inglese |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| Formula molecolare |
C9H9FO |
| Peso Molecolare |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Numero CAS |
455-67-4 |
| Struttura molecolare |
|
| Densità |
1.074g/cm3 |
| Punto di ebollizione |
209.8°C at 760 mmHg |
| Indice di rifrazione |
1.489 |
| Punto d'infiammabilità |
79.8°C |
| Pressione di vapore |
0.199mmHg at 25°C |
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|