455-67-4 3-fluoropropiophenone
| Nom |
3-fluoropropiophenone |
| Nom anglais |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| Formule moléculaire |
C9H9FO |
| Poids Moléculaire |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Numéro de registre CAS |
455-67-4 |
| Structure moléculaire |
|
| Densité |
1.074g/cm3 |
| Point d'ébullition |
209.8°C at 760 mmHg |
| Indice de réfraction |
1.489 |
| Point d'éclair |
79.8°C |
| Pression de vapeur |
0.199mmHg at 25°C |
| Codes des risques |
R36/38:Irritating to eyes and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|