455-67-4 3-fluoropropiophenone
| Produkt-Name |
3-fluoropropiophenone |
| Englischer Name |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| Molekulare Formel |
C9H9FO |
| Molecular Weight |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| CAS Registry Number |
455-67-4 |
| Molecular Structure |
|
| Dichte |
1.074g/cm3 |
| Siedepunkt |
209.8°C at 760 mmHg |
| Brechungsindex |
1.489 |
| Flammpunkt |
79.8°C |
| Dampfdruck |
0.199mmHg at 25°C |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|