455-67-4 3-fluoropropiophenone
| Ονομασ?α του προ??ντο? |
3-fluoropropiophenone |
| Αγγλικ? ?νομα |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| MF |
C9H9FO |
| Μοριακ? β?ρο? |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| CAS ΟΧΙ |
455-67-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.074g/cm3 |
| Σημε?ο βρασμο? |
209.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.489 |
| Σημε?ο αν?φλεξη? |
79.8°C |
| Π?εση ατμ?ν |
0.199mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|