191-07-1 Coronene
| Nome do produto |
Coronene |
| Nome em inglês |
Coronene; Hexabenzobenzene; Coronene (purity) |
| Fórmula molecular |
C24H12 |
| Peso Molecular |
300.3521 |
| InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| CAS Registry Number |
191-07-1 |
| EINECS |
205-881-7 |
| Estrutura Molecular |
|
| Densidade |
1.467g/cm3 |
| Ponto de fus?o |
438-440℃ |
| Ponto de ebuli??o |
525.6°C at 760 mmHg |
| índice de refra??o |
2.139 |
| O ponto de inflama??o |
265.2°C |
| Press?o de vapor |
1.3E-10mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S36/37:Wear suitable protective clothing and gloves.;
|
|