191-07-1 Coronene
| product Name |
Coronene |
| CAS No |
191-07-1 |
| Synonyms |
Hexabenzobenzene; Coronene (purity) |
| Molecular Formula |
C24H12 |
| Molecular Weight |
300.3521 |
| InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| EINECS |
205-881-7 |
| Molecular Structure |
|
| Density |
1.467g/cm3 |
| Melting point |
438-440℃ |
| Boiling point |
525.6°C at 760 mmHg |
| Refractive index |
2.139 |
| Flash point |
265.2°C |
| Vapour Pressur |
1.3E-10mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Gu Xiaoxing |
| Telephone |
+86-519-86461196;86464994 |
| Email |
gxx@xingshengtech.com;gxy@xingshengtech.com |
| Address |
Miaoqiao St.,Wujin District,Changzhou City, Jiangsu, China. |
| Contact |
Mr Owen Lu |
| Telephone |
+86-570-6121003 |
| Email |
hutu@chinahutu.com |
| Address |
2 Yuanyi Road, Kaihua Industrial Park, Zhejiang, China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Shelley Qian |
| Telephone |
021-57857285 |
| Email |
sales02@reliabpharma.com |
| Address |
Lane 1500, No.68, Xinfei Road, Songjiang District, Shanghai, China. |
| Contact |
Miss. Sucy |
| Telephone |
+86 755 27800161 |
| Email |
sales@todabio.com |
| Address |
5th Floor, Building 8, Changyuan New Material Port, No. 2, Gaoxin Zhongyi, Science and Technology Park, Nanshan District, Shenzhen |